Others
Factory supply POLY-L -SERINE 25821-52-7 with sufficient stock and high standard
- Molecular Formula: (C3 H7 N O3)x
- Molecular Weight: 105.0926
- Boiling Point: 394.8°Cat760mmHg
- Flash Point: 192.6°C
- Density: 1.415g/cm3
POLY-L -SERINE(Cas 25821-52-7) Usage
|
General Description |
Poly-L-serine is a homopolymer of the naturally occurring amino acid serine that is often used in laboratory and research settings, particularly in immunological research and biochemistry. The polymer is known for its ability to bind and activate certain proteins, playing a vital role in biological processes such as protein synthesis and enzyme activity. It has also been researched for its potential use in drug delivery and other areas of medicine. Its biochemical properties, such as its ability to form beta sheets and stimulate the production of antimicrobial peptides, contribute to its significance in bioscience. The toxicity levels are relatively low, making it generally safe for use in various applications. |
InChI:InChI=1/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
RELATED PRODUCTS