Export Top Purity 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE 150096-57-4 In Stock We provide high quality 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE (CAS 150096-57-4), at a very affordable prices to our customers.

1.What is the 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE ?

2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is a bicyclic chemical compound with the molecular formula C13H14O, belonging to the benz[indene]ketone group. It is known for its unique structure and reactivity, making it a valuable intermediate in organic synthesis for the production of various pharmaceuticals, agrochemicals, and specialty chemicals.

Used in Pharmaceutical Industry:
2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is used as a building block for the synthesis of various pharmaceuticals. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE serves as a key intermediate for the production of agrochemicals, such as pesticides and herbicides, due to its ability to be incorporated into complex molecular structures.
Used in Specialty Chemicals Industry:
2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is utilized as a starting material for the synthesis of specialty chemicals, which have specific applications in various industries, such as coatings, adhesives, and fragrances.
Used in Material Development:
This chemical compound has potential applications in the development of new materials, thanks to its unique properties and reactivity, which can be harnessed to create innovative materials with specific characteristics.
Used in Organic Chemistry Research:
2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is employed as a research tool in the field of organic chemistry, where its reactivity and structure can be studied to gain insights into new reaction mechanisms and the synthesis of novel compounds.
Used in Drug Discovery:
In drug discovery, 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE serves as a valuable intermediate for the development of new drug candidates, as its unique structure can be modified to create compounds with potential therapeutic effects.

2.What is the CAS number for 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE ?

The CAS number of 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is 150096-57-4.

More information of 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE 150096-57-4 are:

3.What is the molecular formula of 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE ?

The chemical formula of?2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is C₁₄ H₁₂ O which containing 14 Carbon atoms,12 Hydrogen atoms and 1 Oxygen atoms,and the molecular weight, and the molecular weight of 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is 196.249

4.What is 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE(150096-57-4)used for?

2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE is a bicyclic chemical compound with the molecular formula C13H14O, belonging to the benz[indene]ketone group. It is known for its unique structure and reactivity, making it a valuable intermediate in organic synthesis for the production of various pharmaceuticals, agrochemicals, and specialty chemicals.

InChI:InChI=1/C14H12O/c1-9-8-11-7-6-10-4-2-3-5-12(10)13(11)14(9)15/h2-7,9H,8H2,1H3

Relevant articles related to 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE:

5.Export Top Purity 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE 150096-57-4 In Stock

Shanxi Tianhetong Chemicals Co., Ltd is a quality supplier of 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 2,3-DIHYDRO-2-METHYL-1H-BENZ[E]INDEN-1-ONE 150096-57-4.